C26H23FN4S — CID 145246750
3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine (PubChem CID 145246750) has the molecular formula C26H23FN4S and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine.
| Compound Name | 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 145246750 |
| Molecular Formula | C26H23FN4S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-[4-[(1E)-1-(5-fluorothiophen-2-yl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine |
| SMILES | C=C/C=C\C(=C/C)c1cc2c(-c3cc(/C(=C\C=C)c4ccc(F)s4)c(C)[nH]3)n[nH]c2cn1 |
| InChI | InChI=1S/C26H23FN4S/c1-5-8-10-17(7-3)21-14-20-23(15-28-21)30-31-26(20)22-13-19(16(4)29-22)18(9-6-2)24-11-12-25(27)32-24/h5-15,29H,1-2H2,3-4H3,(H,30,31)/b10-8-,17-7+,18-9+ |
| InChIKey | QOFJHLVCZRKAJT-SMVRWQLZSA-N |
| XLogP | 7.23 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|