C37H44FN5 — CID 145246956
ethane;5-[(2E,4Z)-5-ethenyl-8-pyrrolidin-1-ylocta-2,4-dien-3-yl]-3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-1H-pyrazolo[3,4-c]pyridine (PubChem CID 145246956) has the molecular formula C37H44FN5 and a molecular weight of 577.79 g/mol. Its IUPAC name is ethane;5-[(2E,4Z)-5-ethenyl-8-pyrrolidin-1-ylocta-2,4-dien-3-yl]-3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-1H-pyrazolo[3,4-c]pyridine.
| Compound Name | ethane;5-[(2E,4Z)-5-ethenyl-8-pyrrolidin-1-ylocta-2,4-dien-3-yl]-3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-1H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 145246956 |
| Molecular Formula | C37H44FN5 |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | ethane;5-[(2E,4Z)-5-ethenyl-8-pyrrolidin-1-ylocta-2,4-dien-3-yl]-3-[4-[(1Z)-1-(3-fluorophenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-1H-pyrazolo[3,4-c]pyridine |
| SMILES | C=C/C=C(/c1cccc(F)c1)c1cc(-c2n[nH]c3cnc(C(/C=C(\C=C)CCCN4CCCC4)=C/C)cc23)[nH]c1C.CC |
| InChI | InChI=1S/C35H38FN5.C2H6/c1-5-12-29(27-14-10-15-28(36)20-27)30-21-33(38-24(30)4)35-31-22-32(37-23-34(31)39-40-35)26(7-3)19-25(6-2)13-11-18-41-16-8-9-17-41;1-2/h5-7,10,12,14-15,19-23,38H,1-2,8-9,11,13,16-18H2,3-4H3,(H,39,40);1-2H3/b25-19+,26-7+,29-12-; |
| InChIKey | FHGPWSSHVBENCD-XDVXJQGNSA-N |
| XLogP | 9.44 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|