C30H29FN4 — CID 145250370
3-[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine (PubChem CID 145250370) has the molecular formula C30H29FN4 and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 145250370 |
| Molecular Formula | C30H29FN4 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 3-[4-[(1Z)-1-(3-fluoro-5-methylphenyl)buta-1,3-dienyl]-5-methyl-1H-pyrrol-2-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-2H-pyrazolo[3,4-b]pyridine |
| SMILES | C=C/C=C(/c1cc(C)cc(F)c1)c1cc(-c2[nH]nc3ncc(C(/C=C(/C)C=C)=C/C)cc23)[nH]c1C |
| InChI | InChI=1S/C30H29FN4/c1-7-10-25(22-12-19(5)13-24(31)14-22)26-16-28(33-20(26)6)29-27-15-23(17-32-30(27)35-34-29)21(9-3)11-18(4)8-2/h7-17,33H,1-2H2,3-6H3,(H,32,34,35)/b18-11-,21-9+,25-10- |
| InChIKey | ULZFPRQLQJZESM-UCQHBGSSSA-N |
| XLogP | 7.86 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|