C27H29N5 — CID 145245496
(3E,5E)-N-hex-1-en-2-yl-5-[3-(1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145245496) has the molecular formula C27H29N5 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3E,5E)-N-hex-1-en-2-yl-5-[3-(1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-hex-1-en-2-yl-5-[3-(1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145245496 |
| Molecular Formula | C27H29N5 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (3E,5E)-N-hex-1-en-2-yl-5-[3-(1H-indol-2-yl)-2H-pyrazolo[3,4-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1cnc2n[nH]c(-c3cc4ccccc4[nH]3)c2c1)NC(=C)CCCC |
| InChI | InChI=1S/C27H29N5/c1-5-8-11-18(4)29-22(7-3)14-19(6-2)21-15-23-26(31-32-27(23)28-17-21)25-16-20-12-9-10-13-24(20)30-25/h6-7,9-10,12-17,29-30H,3-5,8,11H2,1-2H3,(H,28,31,32)/b19-6+,22-14+ |
| InChIKey | VNXNGUNHAGLLTQ-VPRIHQAKSA-N |
| XLogP | 6.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|