C30H31FN8 — CID 145254363
N-[3-[2-[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridin-3-yl]-1H-pyrrolo[2,3-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 145254363) has the molecular formula C30H31FN8 and a molecular weight of 522.63 g/mol. Its IUPAC name is N-[3-[2-[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridin-3-yl]-1H-pyrrolo[2,3-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[3-[2-[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridin-3-yl]-1H-pyrrolo[2,3-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 145254363 |
| Molecular Formula | C30H31FN8 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-[3-[2-[5-[(2E,4E)-5-aminohepta-2,4,6-trien-3-yl]-1H-pyrazolo[4,3-b]pyridin-3-yl]-1H-pyrrolo[2,3-c]pyridin-4-yl]-5-fluorophenyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C(N)=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cc(F)cc(NCCN(C)C)c5)cncc4[nH]3)c2n1 |
| InChI | InChI=1S/C30H31FN8/c1-5-18(12-21(32)6-2)25-7-8-26-29(36-25)30(38-37-26)27-15-23-24(16-33-17-28(23)35-27)19-11-20(31)14-22(13-19)34-9-10-39(3)4/h5-8,11-17,34-35H,2,9-10,32H2,1,3-4H3,(H,37,38)/b18-5+,21-12+ |
| InChIKey | OIEVNIUEDMZCSJ-DZWJXXHOSA-N |
| XLogP | 5.71 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|