C24H22N8 — CID 145254310
(3E,5E)-5-[3-[4-(4-methylimidazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145254310) has the molecular formula C24H22N8 and a molecular weight of 422.50 g/mol. Its IUPAC name is (3E,5E)-5-[3-[4-(4-methylimidazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[4-(4-methylimidazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145254310 |
| Molecular Formula | C24H22N8 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (3E,5E)-5-[3-[4-(4-methylimidazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-n5cnc(C)c5)cncc4[nH]3)c2n1 |
| InChI | InChI=1S/C24H22N8/c1-4-15(8-16(25)5-2)18-6-7-19-23(29-18)24(31-30-19)20-9-17-21(28-20)10-26-11-22(17)32-12-14(3)27-13-32/h4-13,28H,2,25H2,1,3H3,(H,30,31)/b15-4+,16-8+ |
| InChIKey | VOOIVGMJOAUUGB-KIEZTBNLSA-N |
| XLogP | 4.43 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|