About N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide
N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide (PubChem CID 145039908) has the molecular formula C20H32N4O3
and a molecular weight of 376.50 g/mol. Its IUPAC name is N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 145039908 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)c1cc(C2CC2)on1.O=C(CCN1CCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C13H24N2O.C7H8N2O2/c16-13(8-11-15-9-4-5-10-15)14-12-6-2-1-3-7-12;8-7(10)5-3-6(11-9-5)4-1-2-4/h12H,1-11H2,(H,14,16);3-4H,1-2H2,(H2,8,10) |
| InChIKey | ZFMTYGUMDSYODB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide (CID 145039908) is N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide is NC(=O)c1cc(C2CC2)on1.O=C(CCN1CCCC1)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide?
The InChIKey is ZFMTYGUMDSYODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O.C7H8N2O2/c16-13(8-11-15-9-4-5-10-15)14-12-6-2-1-3-7-12;8-7(10)5-3-6(11-9-5)4-1-2-4/h12H,1-11H2,(H,14,16);3-4H,1-2H2,(H2,8,10).
What are the key properties of N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide?
N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide has a molecular weight of 376.50 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3-pyrrolidin-1-ylpropanamide;5-cyclopropyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 145039908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).