C18H28N4O3S — CID 145040530
5-cyclopropyl-N-[1-(2-morpholin-4-ylethylsulfanyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide (PubChem CID 145040530) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is 5-cyclopropyl-N-[1-(2-morpholin-4-ylethylsulfanyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[1-(2-morpholin-4-ylethylsulfanyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 145040530 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 5-cyclopropyl-N-[1-(2-morpholin-4-ylethylsulfanyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCN(SCCN2CCOCC2)CC1)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C18H28N4O3S/c23-18(16-13-17(25-20-16)14-1-2-14)19-15-3-5-22(6-4-15)26-12-9-21-7-10-24-11-8-21/h13-15H,1-12H2,(H,19,23) |
| InChIKey | UTZHOIVPIQHYSG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|