C24H32N4O3 — CID 145040480
N-[(2R,10bS)-6-oxo-9-piperidin-3-yl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide;molecular hydrogen (PubChem CID 145040480) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[(2R,10bS)-6-oxo-9-piperidin-3-yl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide;molecular hydrogen.
| Compound Name | N-[(2R,10bS)-6-oxo-9-piperidin-3-yl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 145040480 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[(2R,10bS)-6-oxo-9-piperidin-3-yl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-cyclopropyl-1,2-oxazole-3-carboxamide;molecular hydrogen |
| SMILES | O=C(N[C@@H]1CCN2C(=O)c3ccc(C4CCCNC4)cc3[C@@H]2C1)c1cc(C2CC2)on1.[H][H].[H][H] |
| InChI | InChI=1S/C24H28N4O3.2H2/c29-23(20-12-22(31-27-20)14-3-4-14)26-17-7-9-28-21(11-17)19-10-15(5-6-18(19)24(28)30)16-2-1-8-25-13-16;;/h5-6,10,12,14,16-17,21,25H,1-4,7-9,11,13H2,(H,26,29);2*1H/t16?,17-,21+;;/m1../s1 |
| InChIKey | BAGLTLIBPPYVOO-JJUQZECPSA-N |
| XLogP | 3.60 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |