C24H32N4O2S — CID 145040386
N-(2-benzyl-1-piperidin-3-ylsulfanylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide (PubChem CID 145040386) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-(2-benzyl-1-piperidin-3-ylsulfanylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-benzyl-1-piperidin-3-ylsulfanylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 145040386 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-(2-benzyl-1-piperidin-3-ylsulfanylpiperidin-4-yl)-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCN(SC2CCCNC2)C(Cc2ccccc2)C1)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C24H32N4O2S/c29-24(22-15-23(30-27-22)18-8-9-18)26-19-10-12-28(31-21-7-4-11-25-16-21)20(14-19)13-17-5-2-1-3-6-17/h1-3,5-6,15,18-21,25H,4,7-14,16H2,(H,26,29) |
| InChIKey | LNVQRFSQUGXXSL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|