C30H30F2N6O3 — CID 145043413
3-[3,5-difluoro-4-[[2-[C-[4-(methoxymethyl)-6-[(3-methyl-4-pyridinyl)amino]pyrimidin-2-yl]-N-methylcarbonimidoyl]anilino]methyl]phenoxy]propanal (PubChem CID 145043413) has the molecular formula C30H30F2N6O3 and a molecular weight of 560.61 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[[2-[C-[4-(methoxymethyl)-6-[(3-methyl-4-pyridinyl)amino]pyrimidin-2-yl]-N-methylcarbonimidoyl]anilino]methyl]phenoxy]propanal.
| Compound Name | 3-[3,5-difluoro-4-[[2-[C-[4-(methoxymethyl)-6-[(3-methyl-4-pyridinyl)amino]pyrimidin-2-yl]-N-methylcarbonimidoyl]anilino]methyl]phenoxy]propanal |
|---|---|
| PubChem CID | 145043413 |
| Molecular Formula | C30H30F2N6O3 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 3-[3,5-difluoro-4-[[2-[C-[4-(methoxymethyl)-6-[(3-methyl-4-pyridinyl)amino]pyrimidin-2-yl]-N-methylcarbonimidoyl]anilino]methyl]phenoxy]propanal |
| SMILES | C/N=C(\c1nc(COC)cc(Nc2ccncc2C)n1)c1ccccc1NCc1c(F)cc(OCCC=O)cc1F |
| InChI | InChI=1S/C30H30F2N6O3/c1-19-16-34-10-9-26(19)37-28-13-20(18-40-3)36-30(38-28)29(33-2)22-7-4-5-8-27(22)35-17-23-24(31)14-21(15-25(23)32)41-12-6-11-39/h4-5,7-11,13-16,35H,6,12,17-18H2,1-3H3,(H,34,36,37,38)/b33-29- |
| InChIKey | ARTWJTGVSODHAY-IYOYZZHUSA-N |
| XLogP | 5.40 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|