C30H33F2N5O2 — CID 145043324
2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-5-(3-methoxypropyl)-N-pyridin-4-yl-3,4-dihydropyridin-6-amine (PubChem CID 145043324) has the molecular formula C30H33F2N5O2 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-5-(3-methoxypropyl)-N-pyridin-4-yl-3,4-dihydropyridin-6-amine.
| Compound Name | 2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-5-(3-methoxypropyl)-N-pyridin-4-yl-3,4-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 145043324 |
| Molecular Formula | C30H33F2N5O2 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-5-(3-methoxypropyl)-N-pyridin-4-yl-3,4-dihydropyridin-6-amine |
| SMILES | [H]/N=C(\C1=NC(Nc2ccncc2)=C(CCCOC)CC1)c1ccccc1NCc1c(F)cc(OCC)cc1F |
| InChI | InChI=1S/C30H33F2N5O2/c1-3-39-22-17-25(31)24(26(32)18-22)19-35-27-9-5-4-8-23(27)29(33)28-11-10-20(7-6-16-38-2)30(37-28)36-21-12-14-34-15-13-21/h4-5,8-9,12-15,17-18,33,35H,3,6-7,10-11,16,19H2,1-2H3,(H,34,36)/b33-29- |
| InChIKey | NRMJKTWAFNIAEZ-IYOYZZHUSA-N |
| XLogP | 6.72 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|