C19H14ClF2N3O — CID 144714199
4-[[2-(4-chloropyridine-2-carboximidoyl)anilino]methyl]-3,5-difluorophenol (PubChem CID 144714199) has the molecular formula C19H14ClF2N3O and a molecular weight of 373.79 g/mol. Its IUPAC name is 4-[[2-(4-chloropyridine-2-carboximidoyl)anilino]methyl]-3,5-difluorophenol.
| Compound Name | 4-[[2-(4-chloropyridine-2-carboximidoyl)anilino]methyl]-3,5-difluorophenol |
|---|---|
| PubChem CID | 144714199 |
| Molecular Formula | C19H14ClF2N3O |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-[[2-(4-chloropyridine-2-carboximidoyl)anilino]methyl]-3,5-difluorophenol |
| SMILES | [H]/N=C(\c1cc(Cl)ccn1)c1ccccc1NCc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C19H14ClF2N3O/c20-11-5-6-24-18(7-11)19(23)13-3-1-2-4-17(13)25-10-14-15(21)8-12(26)9-16(14)22/h1-9,23,25-26H,10H2/b23-19- |
| InChIKey | IPMYTAKADJFYDZ-NMWGTECJSA-N |
| XLogP | 4.75 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|