C18H14Cl2N4OS — CID 163876538
2-[2-[(2,4-dichlorophenyl)methylamino]phenyl]-2-imino-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 163876538) has the molecular formula C18H14Cl2N4OS and a molecular weight of 405.31 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenyl)methylamino]phenyl]-2-imino-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[2-[(2,4-dichlorophenyl)methylamino]phenyl]-2-imino-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 163876538 |
| Molecular Formula | C18H14Cl2N4OS |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenyl)methylamino]phenyl]-2-imino-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | [H]/N=C(\C(=O)Nc1nccs1)c1ccccc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2N4OS/c19-12-6-5-11(14(20)9-12)10-23-15-4-2-1-3-13(15)16(21)17(25)24-18-22-7-8-26-18/h1-9,21,23H,10H2,(H,22,24,25)/b21-16- |
| InChIKey | PPJMRTFZZOBKNB-PGMHBOJBSA-N |
| XLogP | 5.07 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|