C15H14Cl2N4OS — CID 143191965
2-[2-[(2,4-dichlorophenyl)methylamino]-4-sulfanylphenyl]-2-iminoacetohydrazide (PubChem CID 143191965) has the molecular formula C15H14Cl2N4OS and a molecular weight of 369.28 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenyl)methylamino]-4-sulfanylphenyl]-2-iminoacetohydrazide.
| Compound Name | 2-[2-[(2,4-dichlorophenyl)methylamino]-4-sulfanylphenyl]-2-iminoacetohydrazide |
|---|---|
| PubChem CID | 143191965 |
| Molecular Formula | C15H14Cl2N4OS |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenyl)methylamino]-4-sulfanylphenyl]-2-iminoacetohydrazide |
| SMILES | [H]/N=C(\C(=O)NN)c1ccc(S)cc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N4OS/c16-9-2-1-8(12(17)5-9)7-20-13-6-10(23)3-4-11(13)14(18)15(22)21-19/h1-6,18,20,23H,7,19H2,(H,21,22)/b18-14- |
| InChIKey | YLLDJMKGJAWLHV-JXAWBTAJSA-N |
| XLogP | 3.25 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|