C20H17Cl2F3N2O2 — CID 143192048
ethyl (E)-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enoate (PubChem CID 143192048) has the molecular formula C20H17Cl2F3N2O2 and a molecular weight of 445.27 g/mol. Its IUPAC name is ethyl (E)-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enoate.
| Compound Name | ethyl (E)-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enoate |
|---|---|
| PubChem CID | 143192048 |
| Molecular Formula | C20H17Cl2F3N2O2 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | ethyl (E)-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enoate |
| SMILES | [H]/N=C(\C=C\C(=O)OCC)c1ccc(C(F)(F)F)cc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2F3N2O2/c1-2-29-19(28)8-7-17(26)15-6-4-13(20(23,24)25)9-18(15)27-11-12-3-5-14(21)10-16(12)22/h3-10,26-27H,2,11H2,1H3/b8-7+,26-17+ |
| InChIKey | AXFBIWHLLRQSPX-MASRVGJZSA-N |
| XLogP | 6.11 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|