C16H13Cl2F3N4O — CID 143191952
2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-2-iminoacetohydrazide (PubChem CID 143191952) has the molecular formula C16H13Cl2F3N4O and a molecular weight of 405.21 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-2-iminoacetohydrazide.
| Compound Name | 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-2-iminoacetohydrazide |
|---|---|
| PubChem CID | 143191952 |
| Molecular Formula | C16H13Cl2F3N4O |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-2-iminoacetohydrazide |
| SMILES | [H]/N=C(\C(=O)NN)c1ccc(C(F)(F)F)cc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2F3N4O/c17-10-3-1-8(12(18)6-10)7-24-13-5-9(16(19,20)21)2-4-11(13)14(22)15(26)25-23/h1-6,22,24H,7,23H2,(H,25,26)/b22-14- |
| InChIKey | BYUBQFZSNSDRBY-HMAPJEAMSA-N |
| XLogP | 3.98 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|