C16H11F5N2O2 — CID 143191982
2-[2-[(2,4-difluorophenyl)methylamino]-5-(trifluoromethyl)phenyl]-2-iminoacetic acid (PubChem CID 143191982) has the molecular formula C16H11F5N2O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2-[2-[(2,4-difluorophenyl)methylamino]-5-(trifluoromethyl)phenyl]-2-iminoacetic acid.
| Compound Name | 2-[2-[(2,4-difluorophenyl)methylamino]-5-(trifluoromethyl)phenyl]-2-iminoacetic acid |
|---|---|
| PubChem CID | 143191982 |
| Molecular Formula | C16H11F5N2O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[2-[(2,4-difluorophenyl)methylamino]-5-(trifluoromethyl)phenyl]-2-iminoacetic acid |
| SMILES | [H]/N=C(\C(=O)O)c1cc(C(F)(F)F)ccc1NCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H11F5N2O2/c17-10-3-1-8(12(18)6-10)7-23-13-4-2-9(16(19,20)21)5-11(13)14(22)15(24)25/h1-6,22-23H,7H2,(H,24,25)/b22-14- |
| InChIKey | UQVZULSIQBZMDG-HMAPJEAMSA-N |
| XLogP | 4.05 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|