C23H23Cl2N3O3 — CID 130444234
ethyl 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(1-formyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-2-iminoacetate (PubChem CID 130444234) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is ethyl 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(1-formyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-2-iminoacetate.
| Compound Name | ethyl 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(1-formyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-2-iminoacetate |
|---|---|
| PubChem CID | 130444234 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | ethyl 2-[2-[(2,4-dichlorophenyl)methylamino]-4-(1-formyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)c1ccc(C2=CCN(C=O)CC2)cc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-2-31-23(30)22(26)19-6-4-16(15-7-9-28(14-29)10-8-15)11-21(19)27-13-17-3-5-18(24)12-20(17)25/h3-7,11-12,14,26-27H,2,8-10,13H2,1H3/b26-22- |
| InChIKey | PLXUMNAMPKELMI-ROMGYVFFSA-N |
| XLogP | 4.78 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|