C18H16Cl2F3N5 — CID 143191976
(E)-N'-amino-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enimidamide (PubChem CID 143191976) has the molecular formula C18H16Cl2F3N5 and a molecular weight of 430.26 g/mol. Its IUPAC name is (E)-N'-amino-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enimidamide.
| Compound Name | (E)-N'-amino-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enimidamide |
|---|---|
| PubChem CID | 143191976 |
| Molecular Formula | C18H16Cl2F3N5 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (E)-N'-amino-4-[2-[(2,4-dichlorophenyl)methylamino]-4-(trifluoromethyl)phenyl]-4-iminobut-2-enimidamide |
| SMILES | [H]/N=C(\C=C\C(N)=N\N)c1ccc(C(F)(F)F)cc1NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2F3N5/c19-12-3-1-10(14(20)8-12)9-27-16-7-11(18(21,22)23)2-4-13(16)15(24)5-6-17(25)28-26/h1-8,24,27H,9,26H2,(H2,25,28)/b6-5+,24-15+ |
| InChIKey | HUUUSZNDIMSDET-QOZUZQNYSA-N |
| XLogP | 4.78 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|