C19H14FN5 — CID 145044232
5-[3-(4-fluorophenyl)imidazo[4,5-c]pyridin-2-yl]-2-(methylideneamino)aniline (PubChem CID 145044232) has the molecular formula C19H14FN5 and a molecular weight of 331.35 g/mol. Its IUPAC name is 5-[3-(4-fluorophenyl)imidazo[4,5-c]pyridin-2-yl]-2-(methylideneamino)aniline.
| Compound Name | 5-[3-(4-fluorophenyl)imidazo[4,5-c]pyridin-2-yl]-2-(methylideneamino)aniline |
|---|---|
| PubChem CID | 145044232 |
| Molecular Formula | C19H14FN5 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-[3-(4-fluorophenyl)imidazo[4,5-c]pyridin-2-yl]-2-(methylideneamino)aniline |
| SMILES | C=Nc1ccc(-c2nc3ccncc3n2-c2ccc(F)cc2)cc1N |
| InChI | InChI=1S/C19H14FN5/c1-22-16-7-2-12(10-15(16)21)19-24-17-8-9-23-11-18(17)25(19)14-5-3-13(20)4-6-14/h2-11H,1,21H2 |
| InChIKey | VEKNLOMZRHKVKO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|