C22H21FN6S — CID 166766311
3-(4-fluorophenyl)-2-[6-(4-methylsulfanylpiperazin-1-yl)-3-pyridinyl]imidazo[4,5-c]pyridine (PubChem CID 166766311) has the molecular formula C22H21FN6S and a molecular weight of 420.52 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[6-(4-methylsulfanylpiperazin-1-yl)-3-pyridinyl]imidazo[4,5-c]pyridine.
| Compound Name | 3-(4-fluorophenyl)-2-[6-(4-methylsulfanylpiperazin-1-yl)-3-pyridinyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 166766311 |
| Molecular Formula | C22H21FN6S |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[6-(4-methylsulfanylpiperazin-1-yl)-3-pyridinyl]imidazo[4,5-c]pyridine |
| SMILES | CSN1CCN(c2ccc(-c3nc4ccncc4n3-c3ccc(F)cc3)cn2)CC1 |
| InChI | InChI=1S/C22H21FN6S/c1-30-28-12-10-27(11-13-28)21-7-2-16(14-25-21)22-26-19-8-9-24-15-20(19)29(22)18-5-3-17(23)4-6-18/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | VNCBMZFRWDXHHV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|