C22H21N5 — CID 118962434
3-(6-methyl-3-pyridinyl)-2-(4-pyrrolidin-1-ylphenyl)imidazo[4,5-c]pyridine (PubChem CID 118962434) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is 3-(6-methyl-3-pyridinyl)-2-(4-pyrrolidin-1-ylphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 3-(6-methyl-3-pyridinyl)-2-(4-pyrrolidin-1-ylphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 118962434 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-(6-methyl-3-pyridinyl)-2-(4-pyrrolidin-1-ylphenyl)imidazo[4,5-c]pyridine |
| SMILES | Cc1ccc(-n2c(-c3ccc(N4CCCC4)cc3)nc3ccncc32)cn1 |
| InChI | InChI=1S/C22H21N5/c1-16-4-7-19(14-24-16)27-21-15-23-11-10-20(21)25-22(27)17-5-8-18(9-6-17)26-12-2-3-13-26/h4-11,14-15H,2-3,12-13H2,1H3 |
| InChIKey | ISJIRQJKFLCQOZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|