C24H25N5O2 — CID 178174168
4-methyl-6-[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]pyridin-2-yl]benzene-1,3-diol (PubChem CID 178174168) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-methyl-6-[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]pyridin-2-yl]benzene-1,3-diol.
| Compound Name | 4-methyl-6-[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]pyridin-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 178174168 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-methyl-6-[3-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]pyridin-2-yl]benzene-1,3-diol |
| SMILES | Cc1cc(-c2nc3ccncc3n2-c2ccc(N3CCN(C)CC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C24H25N5O2/c1-16-13-19(23(31)14-22(16)30)24-26-20-7-8-25-15-21(20)29(24)18-5-3-17(4-6-18)28-11-9-27(2)10-12-28/h3-8,13-15,30-31H,9-12H2,1-2H3 |
| InChIKey | WJCFUTGRZKEMTF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|