C19H16N4O2 — CID 178120438
4-[3-(4-aminophenyl)imidazo[4,5-b]pyridin-2-yl]-6-methylbenzene-1,3-diol (PubChem CID 178120438) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-[3-(4-aminophenyl)imidazo[4,5-b]pyridin-2-yl]-6-methylbenzene-1,3-diol.
| Compound Name | 4-[3-(4-aminophenyl)imidazo[4,5-b]pyridin-2-yl]-6-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 178120438 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-[3-(4-aminophenyl)imidazo[4,5-b]pyridin-2-yl]-6-methylbenzene-1,3-diol |
| SMILES | Cc1cc(-c2nc3cccnc3n2-c2ccc(N)cc2)c(O)cc1O |
| InChI | InChI=1S/C19H16N4O2/c1-11-9-14(17(25)10-16(11)24)18-22-15-3-2-8-21-19(15)23(18)13-6-4-12(20)5-7-13/h2-10,24-25H,20H2,1H3 |
| InChIKey | QTEXLUQVGLWJOR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|