C20H15N3O4 — CID 178174126
2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[4,5-b]pyridin-2-yl]benzene-1,4-diol (PubChem CID 178174126) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[4,5-b]pyridin-2-yl]benzene-1,4-diol.
| Compound Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[4,5-b]pyridin-2-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 178174126 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)imidazo[4,5-b]pyridin-2-yl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2nc3cccnc3n2-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C20H15N3O4/c24-13-4-5-16(25)14(11-13)19-22-15-2-1-7-21-20(15)23(19)12-3-6-17-18(10-12)27-9-8-26-17/h1-7,10-11,24-25H,8-9H2 |
| InChIKey | AVXXJQYXZVLIAA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|