About chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol
chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol (PubChem CID 145044371) has the molecular formula C14H27ClN2O
and a molecular weight of 274.84 g/mol. Its IUPAC name is chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol.
Molecular Properties
| Compound Name | chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol |
| PubChem CID | 145044371 |
| Molecular Formula | C14H27ClN2O |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol |
| SMILES | C=C/C(=C\C)CN1CCC(O)(CNC)CC1.CCl |
| InChI | InChI=1S/C13H24N2O.CH3Cl/c1-4-12(5-2)10-15-8-6-13(16,7-9-15)11-14-3;1-2/h4-5,14,16H,1,6-11H2,2-3H3;1H3/b12-5+; |
| InChIKey | SVYCWHIEFOGLTN-NKPNRJPBSA-N |
| XLogP | 2.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol?
The IUPAC name of chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol (CID 145044371) is chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol.
What is the SMILES notation for chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol?
The canonical SMILES for chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol is C=C/C(=C\C)CN1CCC(O)(CNC)CC1.CCl.
What is the InChIKey of chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol?
The InChIKey is SVYCWHIEFOGLTN-NKPNRJPBSA-N. The full InChI is InChI=1S/C13H24N2O.CH3Cl/c1-4-12(5-2)10-15-8-6-13(16,7-9-15)11-14-3;1-2/h4-5,14,16H,1,6-11H2,2-3H3;1H3/b12-5+;.
What are the key properties of chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol?
chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol has a molecular weight of 274.84 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;1-[(E)-2-ethenylbut-2-enyl]-4-(methylaminomethyl)piperidin-4-ol is sourced from PubChem (CID 145044371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).