C13H22N2O — CID 155632193
4-(aminomethyl)-1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol (PubChem CID 155632193) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol.
| Compound Name | 4-(aminomethyl)-1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 155632193 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-(aminomethyl)-1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-ol |
| SMILES | C=C/C=C(\C=C)CN1CCC(O)(CN)CC1 |
| InChI | InChI=1S/C13H22N2O/c1-3-5-12(4-2)10-15-8-6-13(16,11-14)7-9-15/h3-5,16H,1-2,6-11,14H2/b12-5+ |
| InChIKey | OBIUQMAKUOWRMV-LFYBBSHMSA-N |
| XLogP | 1.07 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|