C12H20N2O2 — CID 155239650
(2E)-3-[[4-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]penta-2,4-dienal (PubChem CID 155239650) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is (2E)-3-[[4-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]penta-2,4-dienal.
| Compound Name | (2E)-3-[[4-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 155239650 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (2E)-3-[[4-(aminomethyl)-4-hydroxypiperidin-1-yl]methyl]penta-2,4-dienal |
| SMILES | C=C/C(=C\C=O)CN1CCC(O)(CN)CC1 |
| InChI | InChI=1S/C12H20N2O2/c1-2-11(3-8-15)9-14-6-4-12(16,10-13)5-7-14/h2-3,8,16H,1,4-7,9-10,13H2/b11-3+ |
| InChIKey | HLFJROBGJASUMW-QDEBKDIKSA-N |
| XLogP | 0.08 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|