C21H31N3O3 — CID 145045372
ethane;2-hydroxy-6-[[1-(2-propan-2-ylpyrazol-3-yl)piperidin-2-yl]methoxy]benzaldehyde (PubChem CID 145045372) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is ethane;2-hydroxy-6-[[1-(2-propan-2-ylpyrazol-3-yl)piperidin-2-yl]methoxy]benzaldehyde.
| Compound Name | ethane;2-hydroxy-6-[[1-(2-propan-2-ylpyrazol-3-yl)piperidin-2-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 145045372 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | ethane;2-hydroxy-6-[[1-(2-propan-2-ylpyrazol-3-yl)piperidin-2-yl]methoxy]benzaldehyde |
| SMILES | CC.CC(C)n1nccc1N1CCCCC1COc1cccc(O)c1C=O |
| InChI | InChI=1S/C19H25N3O3.C2H6/c1-14(2)22-19(9-10-20-22)21-11-4-3-6-15(21)13-25-18-8-5-7-17(24)16(18)12-23;1-2/h5,7-10,12,14-15,24H,3-4,6,11,13H2,1-2H3;1-2H3 |
| InChIKey | CNIXYJZJFPPBBL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|