C18H19NO5S — CID 86295502
2-[[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]methoxy]-6-hydroxybenzaldehyde (PubChem CID 86295502) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]methoxy]-6-hydroxybenzaldehyde.
| Compound Name | 2-[[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]methoxy]-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 86295502 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]methoxy]-6-hydroxybenzaldehyde |
| SMILES | O=Cc1c(O)cccc1OC[C@@H]1CCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO5S/c20-12-16-17(21)9-4-10-18(16)24-13-14-6-5-11-19(14)25(22,23)15-7-2-1-3-8-15/h1-4,7-10,12,14,21H,5-6,11,13H2/t14-/m0/s1 |
| InChIKey | NYDZWFBXOVCAIM-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|