C20H30N2O3S — CID 42065160
2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]-N-cycloheptylacetamide (PubChem CID 42065160) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]-N-cycloheptylacetamide.
| Compound Name | 2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 42065160 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-[(2S)-1-(benzenesulfonyl)piperidin-2-yl]-N-cycloheptylacetamide |
| SMILES | O=C(C[C@@H]1CCCCN1S(=O)(=O)c1ccccc1)NC1CCCCCC1 |
| InChI | InChI=1S/C20H30N2O3S/c23-20(21-17-10-4-1-2-5-11-17)16-18-12-8-9-15-22(18)26(24,25)19-13-6-3-7-14-19/h3,6-7,13-14,17-18H,1-2,4-5,8-12,15-16H2,(H,21,23)/t18-/m0/s1 |
| InChIKey | FWIWCPXIXLVTJE-SFHVURJKSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |