C22H22F2N6 — CID 145046937
N-butyl-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(2H-pyrrol-5-yl)pyrazol-3-yl]pyrimidin-4-amine (PubChem CID 145046937) has the molecular formula C22H22F2N6 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-butyl-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(2H-pyrrol-5-yl)pyrazol-3-yl]pyrimidin-4-amine.
| Compound Name | N-butyl-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(2H-pyrrol-5-yl)pyrazol-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145046937 |
| Molecular Formula | C22H22F2N6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-butyl-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(2H-pyrrol-5-yl)pyrazol-3-yl]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(-c2cc(C3=NCC=C3)n(Cc3ccccc3F)n2)ncc1F |
| InChI | InChI=1S/C22H22F2N6/c1-2-3-10-26-21-17(24)13-27-22(28-21)19-12-20(18-9-6-11-25-18)30(29-19)14-15-7-4-5-8-16(15)23/h4-9,12-13H,2-3,10-11,14H2,1H3,(H,26,27,28) |
| InChIKey | DWEVXZUDBUEXHO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|