C22H20F3N5 — CID 159266152
N-butyl-5-fluoro-2-[7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidin-4-amine (PubChem CID 159266152) has the molecular formula C22H20F3N5 and a molecular weight of 411.43 g/mol. Its IUPAC name is N-butyl-5-fluoro-2-[7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidin-4-amine.
| Compound Name | N-butyl-5-fluoro-2-[7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 159266152 |
| Molecular Formula | C22H20F3N5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-butyl-5-fluoro-2-[7-fluoro-1-[(2-fluorophenyl)methyl]indazol-3-yl]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(-c2nn(Cc3ccccc3F)c3c(F)cccc23)ncc1F |
| InChI | InChI=1S/C22H20F3N5/c1-2-3-11-26-21-18(25)12-27-22(28-21)19-15-8-6-10-17(24)20(15)30(29-19)13-14-7-4-5-9-16(14)23/h4-10,12H,2-3,11,13H2,1H3,(H,26,27,28) |
| InChIKey | WMAUESIINJRILD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|