C25H22F5N7O — CID 71285652
2-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5,5-dimethyl-4-(4,4,4-trifluorobutylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 71285652) has the molecular formula C25H22F5N7O and a molecular weight of 531.49 g/mol. Its IUPAC name is 2-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5,5-dimethyl-4-(4,4,4-trifluorobutylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5,5-dimethyl-4-(4,4,4-trifluorobutylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 71285652 |
| Molecular Formula | C25H22F5N7O |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5,5-dimethyl-4-(4,4,4-trifluorobutylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-c3nn(Cc4ccccc4F)c4ncc(F)cc34)nc(NCCCC(F)(F)F)c21 |
| InChI | InChI=1S/C25H22F5N7O/c1-24(2)17-19(31-9-5-8-25(28,29)30)33-21(34-20(17)35-23(24)38)18-15-10-14(26)11-32-22(15)37(36-18)12-13-6-3-4-7-16(13)27/h3-4,6-7,10-11H,5,8-9,12H2,1-2H3,(H2,31,33,34,35,38) |
| InChIKey | FWFMLWJBVLMQND-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|