C23H19F2N7O — CID 169020923
3-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one (PubChem CID 169020923) has the molecular formula C23H19F2N7O and a molecular weight of 447.45 g/mol. Its IUPAC name is 3-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one.
| Compound Name | 3-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one |
|---|---|
| PubChem CID | 169020923 |
| Molecular Formula | C23H19F2N7O |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one |
| SMILES | CC12CCNc3nc(-c4nn(Cc5ccccc5F)c5ncc(F)cc45)nc(c31)NC(=O)C2 |
| InChI | InChI=1S/C23H19F2N7O/c1-23-6-7-26-19-17(23)20(28-16(33)9-23)30-21(29-19)18-14-8-13(24)10-27-22(14)32(31-18)11-12-4-2-3-5-15(12)25/h2-5,8,10H,6-7,9,11H2,1H3,(H2,26,28,29,30,33) |
| InChIKey | UJZBPKILEHNATM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |