C23H18F3N7O — CID 169020939
(9R)-3-[1-[(2,6-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one (PubChem CID 169020939) has the molecular formula C23H18F3N7O and a molecular weight of 465.44 g/mol. Its IUPAC name is (9R)-3-[1-[(2,6-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one.
| Compound Name | (9R)-3-[1-[(2,6-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one |
|---|---|
| PubChem CID | 169020939 |
| Molecular Formula | C23H18F3N7O |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (9R)-3-[1-[(2,6-difluorophenyl)methyl]-5-fluoropyrazolo[5,4-b]pyridin-3-yl]-9-methyl-2,4,6,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4-trien-7-one |
| SMILES | C[C@]12CCNc3nc(-c4nn(Cc5c(F)cccc5F)c5ncc(F)cc45)nc(c31)NC(=O)C2 |
| InChI | InChI=1S/C23H18F3N7O/c1-23-5-6-27-19-17(23)20(29-16(34)8-23)31-21(30-19)18-12-7-11(24)9-28-22(12)33(32-18)10-13-14(25)3-2-4-15(13)26/h2-4,7,9H,5-6,8,10H2,1H3,(H2,27,29,30,31,34)/t23-/m1/s1 |
| InChIKey | UHYOZQMQTACZLN-HSZRJFAPSA-N |
| XLogP | 3.77 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |