C23H16F2N6O3 — CID 170092926
(4R)-4-acetyl-10-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-oxa-2,9,11-triazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-one (PubChem CID 170092926) has the molecular formula C23H16F2N6O3 and a molecular weight of 462.42 g/mol. Its IUPAC name is (4R)-4-acetyl-10-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-oxa-2,9,11-triazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-one.
| Compound Name | (4R)-4-acetyl-10-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-oxa-2,9,11-triazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-one |
|---|---|
| PubChem CID | 170092926 |
| Molecular Formula | C23H16F2N6O3 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (4R)-4-acetyl-10-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7-oxa-2,9,11-triazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-one |
| SMILES | CC(=O)[C@@]12CCOc3nc(-c4nn(Cc5ccccc5F)c5ncc(F)cc45)nc(c31)NC2=O |
| InChI | InChI=1S/C23H16F2N6O3/c1-11(32)23-6-7-34-21-16(23)18(29-22(23)33)27-19(28-21)17-14-8-13(24)9-26-20(14)31(30-17)10-12-4-2-3-5-15(12)25/h2-5,8-9H,6-7,10H2,1H3,(H,27,28,29,33)/t23-/m0/s1 |
| InChIKey | NEWNMNXNFXTKFA-QHCPKHFHSA-N |
| XLogP | 2.78 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|