C20H25ClF2N2O2S — CID 145049165
3-[1-(tert-butylsulfanylamino)ethyl]-6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-1H-quinolin-2-one (PubChem CID 145049165) has the molecular formula C20H25ClF2N2O2S and a molecular weight of 430.95 g/mol. Its IUPAC name is 3-[1-(tert-butylsulfanylamino)ethyl]-6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-1H-quinolin-2-one.
| Compound Name | 3-[1-(tert-butylsulfanylamino)ethyl]-6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145049165 |
| Molecular Formula | C20H25ClF2N2O2S |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[1-(tert-butylsulfanylamino)ethyl]-6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-1H-quinolin-2-one |
| SMILES | CC(NSC(C)(C)C)c1cc2cc(Cl)c(OCC3CC(F)(F)C3)cc2[nH]c1=O |
| InChI | InChI=1S/C20H25ClF2N2O2S/c1-11(25-28-19(2,3)4)14-5-13-6-15(21)17(7-16(13)24-18(14)26)27-10-12-8-20(22,23)9-12/h5-7,11-12,25H,8-10H2,1-4H3,(H,24,26) |
| InChIKey | YHUFZCIXPWMJKN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|