C9H16ClN — CID 145049180
ethane;N-[(3Z)-penta-1,3-dien-2-yl]ethanimidoyl chloride (PubChem CID 145049180) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is ethane;N-[(3Z)-penta-1,3-dien-2-yl]ethanimidoyl chloride.
| Compound Name | ethane;N-[(3Z)-penta-1,3-dien-2-yl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 145049180 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | ethane;N-[(3Z)-penta-1,3-dien-2-yl]ethanimidoyl chloride |
| SMILES | C=C(/C=C\C)/N=C(\C)Cl.CC |
| InChI | InChI=1S/C7H10ClN.C2H6/c1-4-5-6(2)9-7(3)8;1-2/h4-5H,2H2,1,3H3;1-2H3/b5-4-,9-7+; |
| InChIKey | KUMMEJKSFYHNLC-NWKPGZOISA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|