About 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane
3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane (PubChem CID 145051173) has the molecular formula C22H25N5O2
and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane.
Molecular Properties
| Compound Name | 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane |
| PubChem CID | 145051173 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane |
| SMILES | CC(C)[N+](=O)[O-].N#Cc1ccc(-c2ccc(-n3ccnc3)cc2)c(CCCN)c1 |
| InChI | InChI=1S/C19H18N4.C3H7NO2/c20-9-1-2-17-12-15(13-21)3-8-19(17)16-4-6-18(7-5-16)23-11-10-22-14-23;1-3(2)4(5)6/h3-8,10-12,14H,1-2,9,20H2;3H,1-2H3 |
| InChIKey | AEEBHKDGCSESAC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane?
The IUPAC name of 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane (CID 145051173) is 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane.
What is the SMILES notation for 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane?
The canonical SMILES for 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane is CC(C)[N+](=O)[O-].N#Cc1ccc(-c2ccc(-n3ccnc3)cc2)c(CCCN)c1.
What is the InChIKey of 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane?
The InChIKey is AEEBHKDGCSESAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4.C3H7NO2/c20-9-1-2-17-12-15(13-21)3-8-19(17)16-4-6-18(7-5-16)23-11-10-22-14-23;1-3(2)4(5)6/h3-8,10-12,14H,1-2,9,20H2;3H,1-2H3.
What are the key properties of 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane?
3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane has a molecular weight of 391.48 g/mol, XLogP of 3.97, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopropyl)-4-(4-imidazol-1-ylphenyl)benzonitrile;2-nitropropane is sourced from PubChem (CID 145051173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).