C23H18N4 — CID 118978757
4-(4-imidazol-1-ylphenyl)-3-(2-pyridin-3-ylethyl)benzonitrile (PubChem CID 118978757) has the molecular formula C23H18N4 and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-(4-imidazol-1-ylphenyl)-3-(2-pyridin-3-ylethyl)benzonitrile.
| Compound Name | 4-(4-imidazol-1-ylphenyl)-3-(2-pyridin-3-ylethyl)benzonitrile |
|---|---|
| PubChem CID | 118978757 |
| Molecular Formula | C23H18N4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-(4-imidazol-1-ylphenyl)-3-(2-pyridin-3-ylethyl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-n3ccnc3)cc2)c(CCc2cccnc2)c1 |
| InChI | InChI=1S/C23H18N4/c24-15-19-4-10-23(21(14-19)5-3-18-2-1-11-25-16-18)20-6-8-22(9-7-20)27-13-12-26-17-27/h1-2,4,6-14,16-17H,3,5H2 |
| InChIKey | VEUUBWMLQFYEAE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |