C28H32S5 — CID 145051385
5,9-bis(5-hexylthiophen-3-yl)-4,7,10-trithiatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene (PubChem CID 145051385) has the molecular formula C28H32S5 and a molecular weight of 528.90 g/mol. Its IUPAC name is 5,9-bis(5-hexylthiophen-3-yl)-4,7,10-trithiatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene.
| Compound Name | 5,9-bis(5-hexylthiophen-3-yl)-4,7,10-trithiatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene |
|---|---|
| PubChem CID | 145051385 |
| Molecular Formula | C28H32S5 |
| Molecular Weight | 528.90 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 5,9-bis(5-hexylthiophen-3-yl)-4,7,10-trithiatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene |
| SMILES | CCCCCCc1cc(-c2scc3c2sc2c(-c4csc(CCCCCC)c4)scc23)cs1 |
| InChI | InChI=1S/C28H32S5/c1-3-5-7-9-11-21-13-19(15-29-21)25-27-23(17-31-25)24-18-32-26(28(24)33-27)20-14-22(30-16-20)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3 |
| InChIKey | UOYMFTFUQCHWBM-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.90 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|