C18H19N4O3+ — CID 145051653
[(E)-3-hydroxy-2-[[2-methyl-5-(pyridine-4-carbonylamino)phenyl]carbamoyl]but-2-enylidene]azanium (PubChem CID 145051653) has the molecular formula C18H19N4O3+ and a molecular weight of 339.38 g/mol. Its IUPAC name is [(E)-3-hydroxy-2-[[2-methyl-5-(pyridine-4-carbonylamino)phenyl]carbamoyl]but-2-enylidene]azanium.
| Compound Name | [(E)-3-hydroxy-2-[[2-methyl-5-(pyridine-4-carbonylamino)phenyl]carbamoyl]but-2-enylidene]azanium |
|---|---|
| PubChem CID | 145051653 |
| Molecular Formula | C18H19N4O3+ |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [(E)-3-hydroxy-2-[[2-methyl-5-(pyridine-4-carbonylamino)phenyl]carbamoyl]but-2-enylidene]azanium |
| SMILES | C/C(O)=C(/C=[NH2+])C(=O)Nc1cc(NC(=O)c2ccncc2)ccc1C |
| InChI | InChI=1S/C18H18N4O3/c1-11-3-4-14(21-17(24)13-5-7-20-8-6-13)9-16(11)22-18(25)15(10-19)12(2)23/h3-10,19,23H,1-2H3,(H,21,24)(H,22,25)/p+1/b15-12+,19-10? |
| InChIKey | BKNBEXXATZKVCI-BAXAWLPISA-O |
| XLogP | 1.24 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|