C18H18N4O3 — CID 145051654
N-[3-[[(E)-3-hydroxy-2-methanimidoylbut-2-enoyl]amino]-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 145051654) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[3-[[(E)-3-hydroxy-2-methanimidoylbut-2-enoyl]amino]-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[(E)-3-hydroxy-2-methanimidoylbut-2-enoyl]amino]-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145051654 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[3-[[(E)-3-hydroxy-2-methanimidoylbut-2-enoyl]amino]-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | [H]/N=C/C(C(=O)Nc1cc(NC(=O)c2ccncc2)ccc1C)=C(/C)O |
| InChI | InChI=1S/C18H18N4O3/c1-11-3-4-14(21-17(24)13-5-7-20-8-6-13)9-16(11)22-18(25)15(10-19)12(2)23/h3-10,19,23H,1-2H3,(H,21,24)(H,22,25)/b15-12+,19-10+ |
| InChIKey | BKNBEXXATZKVCI-UCOHCWLBSA-N |
| XLogP | 3.06 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|