C29H50N10 — CID 145051859
ethane;N'-hexan-3-yl-N-[3-[4-[[(4-piperazin-1-ylquinazolin-2-yl)amino]methyl]triazol-1-yl]propyl]propane-1,3-diamine (PubChem CID 145051859) has the molecular formula C29H50N10 and a molecular weight of 538.79 g/mol. Its IUPAC name is ethane;N'-hexan-3-yl-N-[3-[4-[[(4-piperazin-1-ylquinazolin-2-yl)amino]methyl]triazol-1-yl]propyl]propane-1,3-diamine.
| Compound Name | ethane;N'-hexan-3-yl-N-[3-[4-[[(4-piperazin-1-ylquinazolin-2-yl)amino]methyl]triazol-1-yl]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 145051859 |
| Molecular Formula | C29H50N10 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | ethane;N'-hexan-3-yl-N-[3-[4-[[(4-piperazin-1-ylquinazolin-2-yl)amino]methyl]triazol-1-yl]propyl]propane-1,3-diamine |
| SMILES | CC.CCCC(CC)NCCCNCCCn1cc(CNc2nc(N3CCNCC3)c3ccccc3n2)nn1 |
| InChI | InChI=1S/C27H44N10.C2H6/c1-3-9-22(4-2)30-14-7-12-28-13-8-17-37-21-23(34-35-37)20-31-27-32-25-11-6-5-10-24(25)26(33-27)36-18-15-29-16-19-36;1-2/h5-6,10-11,21-22,28-30H,3-4,7-9,12-20H2,1-2H3,(H,31,32,33);1-2H3 |
| InChIKey | AQGYQFDAFQQMHN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|