C15H32N6 — CID 145051848
N-[3-[4-(aminomethyl)triazol-1-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine (PubChem CID 145051848) has the molecular formula C15H32N6 and a molecular weight of 296.46 g/mol. Its IUPAC name is N-[3-[4-(aminomethyl)triazol-1-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine.
| Compound Name | N-[3-[4-(aminomethyl)triazol-1-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145051848 |
| Molecular Formula | C15H32N6 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | N-[3-[4-(aminomethyl)triazol-1-yl]propyl]-N'-hexan-3-ylpropane-1,3-diamine |
| SMILES | CCCC(CC)NCCCNCCCn1cc(CN)nn1 |
| InChI | InChI=1S/C15H32N6/c1-3-7-14(4-2)18-10-5-8-17-9-6-11-21-13-15(12-16)19-20-21/h13-14,17-18H,3-12,16H2,1-2H3 |
| InChIKey | PRXOQUUJHZPTOU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|