C18H37N5 — CID 142401906
N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine (PubChem CID 142401906) has the molecular formula C18H37N5 and a molecular weight of 323.53 g/mol. Its IUPAC name is N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine.
| Compound Name | N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142401906 |
| Molecular Formula | C18H37N5 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine |
| SMILES | CCCC(CC)NCCCNCCCCn1cnc(CCN)c1 |
| InChI | InChI=1S/C18H37N5/c1-3-8-17(4-2)21-13-7-12-20-11-5-6-14-23-15-18(9-10-19)22-16-23/h15-17,20-21H,3-14,19H2,1-2H3 |
| InChIKey | RATWVJBPWNNEHA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|