About N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine
N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine (PubChem CID 142401906) has the molecular formula C18H37N5
and a molecular weight of 323.53 g/mol. Its IUPAC name is N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine |
| PubChem CID | 142401906 |
| Molecular Formula | C18H37N5 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine |
| SMILES | CCCC(CC)NCCCNCCCCn1cnc(CCN)c1 |
| InChI | InChI=1S/C18H37N5/c1-3-8-17(4-2)21-13-7-12-20-11-5-6-14-23-15-18(9-10-19)22-16-23/h15-17,20-21H,3-14,19H2,1-2H3 |
| InChIKey | RATWVJBPWNNEHA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine?
The IUPAC name of N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine (CID 142401906) is N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine.
What is the SMILES notation for N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine?
The canonical SMILES for N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine is CCCC(CC)NCCCNCCCCn1cnc(CCN)c1.
What is the InChIKey of N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine?
The InChIKey is RATWVJBPWNNEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37N5/c1-3-8-17(4-2)21-13-7-12-20-11-5-6-14-23-15-18(9-10-19)22-16-23/h15-17,20-21H,3-14,19H2,1-2H3.
What are the key properties of N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine?
N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine has a molecular weight of 323.53 g/mol, XLogP of 2.31, 15 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(2-aminoethyl)imidazol-1-yl]butyl]-N'-hexan-3-ylpropane-1,3-diamine is sourced from PubChem (CID 142401906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).