C24H40N6O2S — CID 142401900
N'-hexan-3-yl-N-[4-[4-[2-[(2-nitrophenyl)sulfanylamino]ethyl]imidazol-1-yl]butyl]propane-1,3-diamine (PubChem CID 142401900) has the molecular formula C24H40N6O2S and a molecular weight of 476.69 g/mol. Its IUPAC name is N'-hexan-3-yl-N-[4-[4-[2-[(2-nitrophenyl)sulfanylamino]ethyl]imidazol-1-yl]butyl]propane-1,3-diamine.
| Compound Name | N'-hexan-3-yl-N-[4-[4-[2-[(2-nitrophenyl)sulfanylamino]ethyl]imidazol-1-yl]butyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 142401900 |
| Molecular Formula | C24H40N6O2S |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | N'-hexan-3-yl-N-[4-[4-[2-[(2-nitrophenyl)sulfanylamino]ethyl]imidazol-1-yl]butyl]propane-1,3-diamine |
| SMILES | CCCC(CC)NCCCNCCCCn1cnc(CCNSc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H40N6O2S/c1-3-10-21(4-2)26-16-9-15-25-14-7-8-18-29-19-22(27-20-29)13-17-28-33-24-12-6-5-11-23(24)30(31)32/h5-6,11-12,19-21,25-26,28H,3-4,7-10,13-18H2,1-2H3 |
| InChIKey | XKJGRERXIMKPFO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|