About 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane
2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane (PubChem CID 145052147) has the molecular formula C12H14BrF3O2
and a molecular weight of 327.14 g/mol. Its IUPAC name is 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane.
Molecular Properties
| Compound Name | 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane |
| PubChem CID | 145052147 |
| Molecular Formula | C12H14BrF3O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane |
| SMILES | CCOC.O=CC(Br)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H6BrF3O.C3H8O/c10-8(5-14)6-1-3-7(4-2-6)9(11,12)13;1-3-4-2/h1-5,8H;3H2,1-2H3 |
| InChIKey | VPBNFMWVCRXGOC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane?
The IUPAC name of 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane (CID 145052147) is 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane.
What is the SMILES notation for 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane?
The canonical SMILES for 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane is CCOC.O=CC(Br)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane?
The InChIKey is VPBNFMWVCRXGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF3O.C3H8O/c10-8(5-14)6-1-3-7(4-2-6)9(11,12)13;1-3-4-2/h1-5,8H;3H2,1-2H3.
What are the key properties of 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane?
2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane has a molecular weight of 327.14 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-[4-(trifluoromethyl)phenyl]acetaldehyde;methoxyethane is sourced from PubChem (CID 145052147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).